C22H25N5O4S — CID 135405000
(5Z)-5-[[4-[[2-(3,4-dimethylcyclohexyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 135405000) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is (5Z)-5-[[4-[[2-(3,4-dimethylcyclohexyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[[2-(3,4-dimethylcyclohexyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 135405000 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (5Z)-5-[[4-[[2-(3,4-dimethylcyclohexyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1[nH]n(C2CCC(C)C(C)C2)c(=O)c1/N=N/c1ccc(/C=C2\SC(=O)NC2=O)cc1O |
| InChI | InChI=1S/C22H25N5O4S/c1-11-4-6-15(8-12(11)2)27-21(30)19(13(3)26-27)25-24-16-7-5-14(9-17(16)28)10-18-20(29)23-22(31)32-18/h5,7,9-12,15,26,28H,4,6,8H2,1-3H3,(H,23,29,31)/b18-10-,25-24+ |
| InChIKey | VTORZRMPDATKTC-GUIXEDTBSA-N |
| XLogP | 4.93 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|