About 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide
4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide (PubChem CID 135405216) has the molecular formula C14H12N4O4S
and a molecular weight of 332.34 g/mol. Its IUPAC name is 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide |
| PubChem CID | 135405216 |
| Molecular Formula | C14H12N4O4S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=N/c2c(O)[nH]c3ccc(O)cc23)cc1 |
| InChI | InChI=1S/C14H12N4O4S/c15-23(21,22)10-4-1-8(2-5-10)17-18-13-11-7-9(19)3-6-12(11)16-14(13)20/h1-7,16,19-20H,(H2,15,21,22)/b18-17+ |
| InChIKey | XWRIZUXQGQPRHA-ISLYRVAYSA-N |
| XLogP | 2.64 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide?
The IUPAC name of 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide (CID 135405216) is 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide.
What is the SMILES notation for 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide?
The canonical SMILES for 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide is NS(=O)(=O)c1ccc(/N=N/c2c(O)[nH]c3ccc(O)cc23)cc1.
What is the InChIKey of 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide?
The InChIKey is XWRIZUXQGQPRHA-ISLYRVAYSA-N. The full InChI is InChI=1S/C14H12N4O4S/c15-23(21,22)10-4-1-8(2-5-10)17-18-13-11-7-9(19)3-6-12(11)16-14(13)20/h1-7,16,19-20H,(H2,15,21,22)/b18-17+.
What are the key properties of 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide?
4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide has a molecular weight of 332.34 g/mol, XLogP of 2.64, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dihydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide is sourced from PubChem (CID 135405216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).