C21H25N3O3S — CID 135405465
2-(3-methylbutylsulfanyl)-5-(5-methylfuran-2-yl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135405465) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-(3-methylbutylsulfanyl)-5-(5-methylfuran-2-yl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-(3-methylbutylsulfanyl)-5-(5-methylfuran-2-yl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135405465 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-(3-methylbutylsulfanyl)-5-(5-methylfuran-2-yl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccc(C2C3=C(CCCC3=O)Nc3nc(SCCC(C)C)[nH]c(=O)c32)o1 |
| InChI | InChI=1S/C21H25N3O3S/c1-11(2)9-10-28-21-23-19-18(20(26)24-21)17(15-8-7-12(3)27-15)16-13(22-19)5-4-6-14(16)25/h7-8,11,17H,4-6,9-10H2,1-3H3,(H2,22,23,24,26) |
| InChIKey | YZMKDALFUQUWLH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |