C17H13N3O5S2 — CID 135405692
2-[4-hydroxy-5-[(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid (PubChem CID 135405692) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[4-hydroxy-5-[(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid.
| Compound Name | 2-[4-hydroxy-5-[(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 135405692 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 2-[4-hydroxy-5-[(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)n1c(O)c(C=C2C=NN=C2c2ccccc2)sc1=S |
| InChI | InChI=1S/C17H13N3O5S2/c21-13(22)7-11(16(24)25)20-15(23)12(27-17(20)26)6-10-8-18-19-14(10)9-4-2-1-3-5-9/h1-6,8,11,23H,7H2,(H,21,22)(H,24,25) |
| InChIKey | SJSFWUCAELNRRV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|