C20H12N2O4S2 — CID 1354059
1-[4-(4-oxo-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-2-yl)phenyl]pyrrolidine-2,5-dione (PubChem CID 1354059) has the molecular formula C20H12N2O4S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-[4-(4-oxo-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-2-yl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(4-oxo-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-2-yl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1354059 |
| Molecular Formula | C20H12N2O4S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 1-[4-(4-oxo-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-2-yl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc(-c2nc3scc(-c4cccs4)c3c(=O)o2)cc1 |
| InChI | InChI=1S/C20H12N2O4S2/c23-15-7-8-16(24)22(15)12-5-3-11(4-6-12)18-21-19-17(20(25)26-18)13(10-28-19)14-2-1-9-27-14/h1-6,9-10H,7-8H2 |
| InChIKey | ZNNRPSUHUFLJDM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|