C16H14N2O — CID 135406017
3-(3,4-dimethylphenyl)imino-1H-indol-2-one (PubChem CID 135406017) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)imino-1H-indol-2-one.
| Compound Name | 3-(3,4-dimethylphenyl)imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135406017 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-(3,4-dimethylphenyl)imino-1H-indol-2-one |
| SMILES | Cc1ccc(/N=C2\C(=O)Nc3ccccc32)cc1C |
| InChI | InChI=1S/C16H14N2O/c1-10-7-8-12(9-11(10)2)17-15-13-5-3-4-6-14(13)18-16(15)19/h3-9H,1-2H3,(H,17,18,19) |
| InChIKey | YTYBJPIUORONGK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|