C23H23N3O3S — CID 135406397
5-(3,4-diethoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135406397) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 5-(3,4-diethoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 5-(3,4-diethoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135406397 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 5-(3,4-diethoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | CCOc1ccc(C2=NNC(c3cccs3)=Nc3ccc(OC)cc32)cc1OCC |
| InChI | InChI=1S/C23H23N3O3S/c1-4-28-19-11-8-15(13-20(19)29-5-2)22-17-14-16(27-3)9-10-18(17)24-23(26-25-22)21-7-6-12-30-21/h6-14H,4-5H2,1-3H3,(H,24,26) |
| InChIKey | UZLVZJKIIGTUBX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |