C14H13ClN3O8PS — CID 135406521
4-chloro-3-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzenesulfonic acid (PubChem CID 135406521) has the molecular formula C14H13ClN3O8PS and a molecular weight of 449.77 g/mol. Its IUPAC name is 4-chloro-3-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-chloro-3-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135406521 |
| Molecular Formula | C14H13ClN3O8PS |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | 4-chloro-3-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1nc(/N=N/c2cc(S(=O)(=O)O)ccc2Cl)c2c(c1O)COP(=O)(O)OC2 |
| InChI | InChI=1S/C14H13ClN3O8PS/c1-7-13(19)9-5-25-27(20,21)26-6-10(9)14(16-7)18-17-12-4-8(28(22,23)24)2-3-11(12)15/h2-4,19H,5-6H2,1H3,(H,20,21)(H,22,23,24)/b18-17+ |
| InChIKey | UYWSCLVIBVQUQC-ISLYRVAYSA-N |
| XLogP | 3.56 |
| TPSA | 167.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|