C12H16ClN3O2S — CID 135407182
7-chloro-N-(2-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135407182) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 7-chloro-N-(2-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 7-chloro-N-(2-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135407182 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 7-chloro-N-(2-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CCC(C)(C)/N=C1\Nc2ccc(Cl)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C12H16ClN3O2S/c1-4-12(2,3)15-11-14-9-6-5-8(13)7-10(9)19(17,18)16-11/h5-7H,4H2,1-3H3,(H2,14,15,16) |
| InChIKey | RLHBDBWDXYRDOA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|