C17H15N5O — CID 135407192
3-[1-(4-methylphenyl)tetrazol-5-yl]-1,2-dihydroquinolin-4-ol (PubChem CID 135407192) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-[1-(4-methylphenyl)tetrazol-5-yl]-1,2-dihydroquinolin-4-ol.
| Compound Name | 3-[1-(4-methylphenyl)tetrazol-5-yl]-1,2-dihydroquinolin-4-ol |
|---|---|
| PubChem CID | 135407192 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[1-(4-methylphenyl)tetrazol-5-yl]-1,2-dihydroquinolin-4-ol |
| SMILES | Cc1ccc(-n2nnnc2C2=C(O)c3ccccc3NC2)cc1 |
| InChI | InChI=1S/C17H15N5O/c1-11-6-8-12(9-7-11)22-17(19-20-21-22)14-10-18-15-5-3-2-4-13(15)16(14)23/h2-9,18,23H,10H2,1H3 |
| InChIKey | GZMCICBSOVIDOT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |