About 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one
2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one (PubChem CID 135407245) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one |
| PubChem CID | 135407245 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one |
| SMILES | O=C1C(C2=NCCN2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C12H10N2O2/c15-10-7-3-1-2-4-8(7)11(16)9(10)12-13-5-6-14-12/h1-4,15H,5-6H2,(H,13,14) |
| InChIKey | GRNOZBOYQKNWAF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one (CID 135407245) is 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one is O=C1C(C2=NCCN2)=C(O)c2ccccc21.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one?
The InChIKey is GRNOZBOYQKNWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-10-7-3-1-2-4-8(7)11(16)9(10)12-13-5-6-14-12/h1-4,15H,5-6H2,(H,13,14).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one?
2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one has a molecular weight of 214.22 g/mol, XLogP of 1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxyinden-1-one is sourced from PubChem (CID 135407245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).