About 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine
6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 135407454) has the molecular formula C10H8IN5
and a molecular weight of 325.11 g/mol. Its IUPAC name is 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine.
Molecular Properties
| Compound Name | 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| PubChem CID | 135407454 |
| Molecular Formula | C10H8IN5 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | Nc1nc(N)c2c(cc(I)c3nccc32)[nH]1 |
| InChI | InChI=1S/C10H8IN5/c11-5-3-6-7(4-1-2-14-8(4)5)9(12)16-10(13)15-6/h1-3H,12H2,(H3,13,15,16) |
| InChIKey | AMZLCOAUGBRLSE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
The IUPAC name of 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine (CID 135407454) is 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine.
What is the SMILES notation for 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
The canonical SMILES for 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine is Nc1nc(N)c2c(cc(I)c3nccc32)[nH]1.
What is the InChIKey of 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
The InChIKey is AMZLCOAUGBRLSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8IN5/c11-5-3-6-7(4-1-2-14-8(4)5)9(12)16-10(13)15-6/h1-3H,12H2,(H3,13,15,16).
What are the key properties of 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine has a molecular weight of 325.11 g/mol, XLogP of 1.88, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine is sourced from PubChem (CID 135407454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).