About 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide
2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide (PubChem CID 135407473) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide |
| PubChem CID | 135407473 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide |
| SMILES | O=C(CC1S/C(=N/Cc2ccccc2)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H17N3O2S/c22-16(20-14-9-5-2-6-10-14)11-15-17(23)21-18(24-15)19-12-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,20,22)(H,19,21,23) |
| InChIKey | QLXMQPBTQKBZRH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide?
The IUPAC name of 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide (CID 135407473) is 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide.
What is the SMILES notation for 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide?
The canonical SMILES for 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide is O=C(CC1S/C(=N/Cc2ccccc2)NC1=O)Nc1ccccc1.
What is the InChIKey of 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide?
The InChIKey is QLXMQPBTQKBZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2S/c22-16(20-14-9-5-2-6-10-14)11-15-17(23)21-18(24-15)19-12-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,20,22)(H,19,21,23).
What are the key properties of 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide?
2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide has a molecular weight of 339.42 g/mol, XLogP of 2.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzylimino-4-oxo-1,3-thiazolidin-5-yl)-N-phenylacetamide is sourced from PubChem (CID 135407473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).