C19H24N4O2 — CID 135407844
2-[(E)-N-hydroxy-C-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]carbonimidoyl]-4-methylphenol (PubChem CID 135407844) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[(E)-N-hydroxy-C-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]carbonimidoyl]-4-methylphenol.
| Compound Name | 2-[(E)-N-hydroxy-C-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]carbonimidoyl]-4-methylphenol |
|---|---|
| PubChem CID | 135407844 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-[(E)-N-hydroxy-C-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]carbonimidoyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(/C(CCN2CCN(c3ccccn3)CC2)=N/O)c1 |
| InChI | InChI=1S/C19H24N4O2/c1-15-5-6-18(24)16(14-15)17(21-25)7-9-22-10-12-23(13-11-22)19-4-2-3-8-20-19/h2-6,8,14,24-25H,7,9-13H2,1H3/b21-17+ |
| InChIKey | ZWQOXMHVCXACBK-HEHNFIMWSA-N |
| XLogP | 2.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|