C12H10N4O — CID 135408195
2-methyl-6-phenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one (PubChem CID 135408195) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-methyl-6-phenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one.
| Compound Name | 2-methyl-6-phenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 135408195 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-methyl-6-phenyl-4H-imidazo[1,2-b][1,2,4]triazin-3-one |
| SMILES | Cc1nn2cc(-c3ccccc3)nc2[nH]c1=O |
| InChI | InChI=1S/C12H10N4O/c1-8-11(17)14-12-13-10(7-16(12)15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14,17) |
| InChIKey | UZAFRHFIXAKVPM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |