C9H11N3O3 — CID 135408236
7-(2-hydroxyethoxymethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135408236) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 7-(2-hydroxyethoxymethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-(2-hydroxyethoxymethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135408236 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 7-(2-hydroxyethoxymethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c(COCCO)c[nH]c12 |
| InChI | InChI=1S/C9H11N3O3/c13-1-2-15-4-6-3-10-8-7(6)11-5-12-9(8)14/h3,5,10,13H,1-2,4H2,(H,11,12,14) |
| InChIKey | CWOXLHVCMIKVSP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|