About 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione
6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione (PubChem CID 135408619) has the molecular formula C6H3F3N4S
and a molecular weight of 220.18 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione |
| PubChem CID | 135408619 |
| Molecular Formula | C6H3F3N4S |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione |
| SMILES | FC(F)(F)c1nc(=S)c2cn[nH]c2[nH]1 |
| InChI | InChI=1S/C6H3F3N4S/c7-6(8,9)5-11-3-2(1-10-13-3)4(14)12-5/h1H,(H2,10,11,12,13,14) |
| InChIKey | FYZDBOWURLBXKV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione?
The IUPAC name of 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione (CID 135408619) is 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione.
What is the SMILES notation for 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione?
The canonical SMILES for 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione is FC(F)(F)c1nc(=S)c2cn[nH]c2[nH]1.
What is the InChIKey of 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione?
The InChIKey is FYZDBOWURLBXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N4S/c7-6(8,9)5-11-3-2(1-10-13-3)4(14)12-5/h1H,(H2,10,11,12,13,14).
What are the key properties of 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione?
6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione has a molecular weight of 220.18 g/mol, XLogP of 2.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione is sourced from PubChem (CID 135408619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).