About 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one
2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135408714) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 135408714 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2[nH]ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C6H6N4O/c7-6-9-4-3(1-2-8-4)5(11)10-6/h1-2H,(H4,7,8,9,10,11) |
| InChIKey | OLAFFPNXVJANFR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (CID 135408714) is 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is Nc1nc2[nH]ccc2c(=O)[nH]1.
What is the InChIKey of 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is OLAFFPNXVJANFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c7-6-9-4-3(1-2-8-4)5(11)10-6/h1-2H,(H4,7,8,9,10,11).
What are the key properties of 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 150.14 g/mol, XLogP of -0.17, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 135408714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).