About 4-amino-6-phenyl-1H-1,3,5-triazin-2-one
4-amino-6-phenyl-1H-1,3,5-triazin-2-one (PubChem CID 135408760) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 4-amino-6-phenyl-1H-1,3,5-triazin-2-one.
Molecular Properties
| Compound Name | 4-amino-6-phenyl-1H-1,3,5-triazin-2-one |
| PubChem CID | 135408760 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 4-amino-6-phenyl-1H-1,3,5-triazin-2-one |
| SMILES | Nc1nc(-c2ccccc2)[nH]c(=O)n1 |
| InChI | InChI=1S/C9H8N4O/c10-8-11-7(12-9(14)13-8)6-4-2-1-3-5-6/h1-5H,(H3,10,11,12,13,14) |
| InChIKey | ZBKCUYOBOGCDKC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-6-phenyl-1H-1,3,5-triazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-phenyl-1H-1,3,5-triazin-2-one?
The IUPAC name of 4-amino-6-phenyl-1H-1,3,5-triazin-2-one (CID 135408760) is 4-amino-6-phenyl-1H-1,3,5-triazin-2-one.
What is the SMILES notation for 4-amino-6-phenyl-1H-1,3,5-triazin-2-one?
The canonical SMILES for 4-amino-6-phenyl-1H-1,3,5-triazin-2-one is Nc1nc(-c2ccccc2)[nH]c(=O)n1.
What is the InChIKey of 4-amino-6-phenyl-1H-1,3,5-triazin-2-one?
The InChIKey is ZBKCUYOBOGCDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c10-8-11-7(12-9(14)13-8)6-4-2-1-3-5-6/h1-5H,(H3,10,11,12,13,14).
What are the key properties of 4-amino-6-phenyl-1H-1,3,5-triazin-2-one?
4-amino-6-phenyl-1H-1,3,5-triazin-2-one has a molecular weight of 188.19 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-phenyl-1H-1,3,5-triazin-2-one is sourced from PubChem (CID 135408760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).