About 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one
5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135408784) has the molecular formula C10H8N6O
and a molecular weight of 228.22 g/mol. Its IUPAC name is 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135408784 |
| Molecular Formula | C10H8N6O |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | Nc1nc2nn(-c3ccccc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H8N6O/c11-10-12-8-7(9(17)13-10)14-16(15-8)6-4-2-1-3-5-6/h1-5H,(H3,11,12,13,15,17) |
| InChIKey | OIAXNBVLMBXWJU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one (CID 135408784) is 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one is Nc1nc2nn(-c3ccccc3)nc2c(=O)[nH]1.
What is the InChIKey of 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The InChIKey is OIAXNBVLMBXWJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N6O/c11-10-12-8-7(9(17)13-10)14-16(15-8)6-4-2-1-3-5-6/h1-5H,(H3,11,12,13,15,17).
What are the key properties of 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one has a molecular weight of 228.22 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135408784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).