About 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione
6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione (PubChem CID 135408970) has the molecular formula C8H8N4O2S
and a molecular weight of 224.24 g/mol. Its IUPAC name is 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione.
Molecular Properties
| Compound Name | 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione |
| PubChem CID | 135408970 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione |
| SMILES | CSc1nc2[nH]c(=O)c(C)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C8H8N4O2S/c1-3-6(13)10-5-4(9-3)7(14)12-8(11-5)15-2/h1-2H3,(H2,10,11,12,13,14) |
| InChIKey | BIVZDTOEJMRHRG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione?
The IUPAC name of 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione (CID 135408970) is 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione.
What is the SMILES notation for 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione?
The canonical SMILES for 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione is CSc1nc2[nH]c(=O)c(C)nc2c(=O)[nH]1.
What is the InChIKey of 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione?
The InChIKey is BIVZDTOEJMRHRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2S/c1-3-6(13)10-5-4(9-3)7(14)12-8(11-5)15-2/h1-2H3,(H2,10,11,12,13,14).
What are the key properties of 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione?
6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione has a molecular weight of 224.24 g/mol, XLogP of 0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-methylsulfanyl-3,8-dihydropteridine-4,7-dione is sourced from PubChem (CID 135408970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).