C17H18N6O4 — CID 135408999
N-hydroxy-N'-[4-[[4-[[1-(hydroxyamino)-2-hydroxyiminoethylidene]amino]phenyl]methyl]phenyl]-2-hydroxyiminoethanimidamide (PubChem CID 135408999) has the molecular formula C17H18N6O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-hydroxy-N'-[4-[[4-[[1-(hydroxyamino)-2-hydroxyiminoethylidene]amino]phenyl]methyl]phenyl]-2-hydroxyiminoethanimidamide.
| Compound Name | N-hydroxy-N'-[4-[[4-[[1-(hydroxyamino)-2-hydroxyiminoethylidene]amino]phenyl]methyl]phenyl]-2-hydroxyiminoethanimidamide |
|---|---|
| PubChem CID | 135408999 |
| Molecular Formula | C17H18N6O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-hydroxy-N'-[4-[[4-[[1-(hydroxyamino)-2-hydroxyiminoethylidene]amino]phenyl]methyl]phenyl]-2-hydroxyiminoethanimidamide |
| SMILES | ON=C/C(=N/c1ccc(Cc2ccc(/N=C(/C=NO)NO)cc2)cc1)NO |
| InChI | InChI=1S/C17H18N6O4/c24-18-10-16(22-26)20-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)21-17(23-27)11-19-25/h1-8,10-11,24-27H,9H2,(H,20,22)(H,21,23) |
| InChIKey | YJWAMMSLAHYIDQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|