C20H28N4O — CID 135409198
4-cyclohexylimino-8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 135409198) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-cyclohexylimino-8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 135409198 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-cyclohexylimino-8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CN1CCC2(CC1)/C(=N/C1CCCCC1)NC(=O)N2c1ccccc1 |
| InChI | InChI=1S/C20H28N4O/c1-23-14-12-20(13-15-23)18(21-16-8-4-2-5-9-16)22-19(25)24(20)17-10-6-3-7-11-17/h3,6-7,10-11,16H,2,4-5,8-9,12-15H2,1H3,(H,21,22,25) |
| InChIKey | IYPZARMGQRMALR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|