C12H24ClN5 — CID 135409266
2-ethylimino-N,N-dimethyl-1,3,5-triazaspiro[5.5]undec-4-en-4-amine;hydrochloride (PubChem CID 135409266) has the molecular formula C12H24ClN5 and a molecular weight of 273.81 g/mol. Its IUPAC name is 2-ethylimino-N,N-dimethyl-1,3,5-triazaspiro[5.5]undec-4-en-4-amine;hydrochloride.
| Compound Name | 2-ethylimino-N,N-dimethyl-1,3,5-triazaspiro[5.5]undec-4-en-4-amine;hydrochloride |
|---|---|
| PubChem CID | 135409266 |
| Molecular Formula | C12H24ClN5 |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-ethylimino-N,N-dimethyl-1,3,5-triazaspiro[5.5]undec-4-en-4-amine;hydrochloride |
| SMILES | CC/N=C1\NC(N(C)C)=NC2(CCCCC2)N1.Cl |
| InChI | InChI=1S/C12H23N5.ClH/c1-4-13-10-14-11(17(2)3)16-12(15-10)8-6-5-7-9-12;/h4-9H2,1-3H3,(H2,13,14,15,16);1H |
| InChIKey | OWMGKNITYOZEAK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|