C12H13N5O — CID 135409388
2-amino-6-phenyl-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135409388) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-amino-6-phenyl-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 2-amino-6-phenyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135409388 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-amino-6-phenyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)NC(c1ccccc1)CN2 |
| InChI | InChI=1S/C12H13N5O/c13-12-16-10-9(11(18)17-12)15-8(6-14-10)7-4-2-1-3-5-7/h1-5,8,15H,6H2,(H4,13,14,16,17,18) |
| InChIKey | GCCPWDPPTDJJNJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |