About 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid
2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid (PubChem CID 135409494) has the molecular formula C16H17N3O5
and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid |
| PubChem CID | 135409494 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid |
| SMILES | Cn1c(O)c(/C(Cc2ccccc2)=N/CC(=O)O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H17N3O5/c1-18-14(22)13(15(23)19(2)16(18)24)11(17-9-12(20)21)8-10-6-4-3-5-7-10/h3-7,22H,8-9H2,1-2H3,(H,20,21)/b17-11+ |
| InChIKey | BXCWXTWBCBWQGW-GZTJUZNOSA-N |
| XLogP | -0.09 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid?
The IUPAC name of 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid (CID 135409494) is 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid.
What is the SMILES notation for 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid?
The canonical SMILES for 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid is Cn1c(O)c(/C(Cc2ccccc2)=N/CC(=O)O)c(=O)n(C)c1=O.
What is the InChIKey of 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid?
The InChIKey is BXCWXTWBCBWQGW-GZTJUZNOSA-N. The full InChI is InChI=1S/C16H17N3O5/c1-18-14(22)13(15(23)19(2)16(18)24)11(17-9-12(20)21)8-10-6-4-3-5-7-10/h3-7,22H,8-9H2,1-2H3,(H,20,21)/b17-11+.
What are the key properties of 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid?
2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid has a molecular weight of 331.33 g/mol, XLogP of -0.09, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-phenylethylidene]amino]acetic acid is sourced from PubChem (CID 135409494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).