C27H27F3N4O — CID 135409605
3-[3-[3-[(cyclopropylmethylamino)methyl]phenyl]cyclobutyl]-4-(2,4,5-trifluorophenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one (PubChem CID 135409605) has the molecular formula C27H27F3N4O and a molecular weight of 480.53 g/mol. Its IUPAC name is 3-[3-[3-[(cyclopropylmethylamino)methyl]phenyl]cyclobutyl]-4-(2,4,5-trifluorophenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one.
| Compound Name | 3-[3-[3-[(cyclopropylmethylamino)methyl]phenyl]cyclobutyl]-4-(2,4,5-trifluorophenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135409605 |
| Molecular Formula | C27H27F3N4O |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 3-[3-[3-[(cyclopropylmethylamino)methyl]phenyl]cyclobutyl]-4-(2,4,5-trifluorophenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one |
| SMILES | O=C1CC(c2cc(F)c(F)cc2F)c2c(n[nH]c2C2CC(c3cccc(CNCC4CC4)c3)C2)N1 |
| InChI | InChI=1S/C27H27F3N4O/c28-21-11-23(30)22(29)9-19(21)20-10-24(35)32-27-25(20)26(33-34-27)18-7-17(8-18)16-3-1-2-15(6-16)13-31-12-14-4-5-14/h1-3,6,9,11,14,17-18,20,31H,4-5,7-8,10,12-13H2,(H2,32,33,34,35) |
| InChIKey | HAGDXKZOCVUVPZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|