C9H9F2N3O2S — CID 135409727
N-ethyl-6,7-difluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135409727) has the molecular formula C9H9F2N3O2S and a molecular weight of 261.25 g/mol. Its IUPAC name is N-ethyl-6,7-difluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | N-ethyl-6,7-difluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135409727 |
| Molecular Formula | C9H9F2N3O2S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-ethyl-6,7-difluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC/N=C1\Nc2cc(F)c(F)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C9H9F2N3O2S/c1-2-12-9-13-7-3-5(10)6(11)4-8(7)17(15,16)14-9/h3-4H,2H2,1H3,(H2,12,13,14) |
| InChIKey | ZBLCINDWAYRJOS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|