About 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol
2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol (PubChem CID 135409756) has the molecular formula C19H13NO3
and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol |
| PubChem CID | 135409756 |
| Molecular Formula | C19H13NO3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol |
| SMILES | Oc1ccc(-c2nc3cc(O)cc(-c4ccccc4)c3o2)cc1 |
| InChI | InChI=1S/C19H13NO3/c21-14-8-6-13(7-9-14)19-20-17-11-15(22)10-16(18(17)23-19)12-4-2-1-3-5-12/h1-11,21-22H |
| InChIKey | OMOPCSHWHZVQPY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol?
The IUPAC name of 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol (CID 135409756) is 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol.
What is the SMILES notation for 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol?
The canonical SMILES for 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol is Oc1ccc(-c2nc3cc(O)cc(-c4ccccc4)c3o2)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol?
The InChIKey is OMOPCSHWHZVQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO3/c21-14-8-6-13(7-9-14)19-20-17-11-15(22)10-16(18(17)23-19)12-4-2-1-3-5-12/h1-11,21-22H.
What are the key properties of 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol?
2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol has a molecular weight of 303.32 g/mol, XLogP of 4.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-7-phenyl-1,3-benzoxazol-5-ol is sourced from PubChem (CID 135409756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).