C56H54N4O12 — CID 135410161
5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135410161) has the molecular formula C56H54N4O12 and a molecular weight of 975.06 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135410161 |
| Molecular Formula | C56H54N4O12 |
| Molecular Weight | 975.06 g/mol |
| Exact Mass | 974.37 |
| IUPAC Name | 5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(-c2c3nc(c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([nH]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(c(-c5cc(OC)c(OC)c(OC)c5)c5ccc2[nH]5)C=C4)C=C3)cc(OC)c1OC |
| InChI | InChI=1S/C56H54N4O12/c1-61-41-21-29(22-42(62-2)53(41)69-9)49-33-13-15-35(57-33)50(30-23-43(63-3)54(70-10)44(24-30)64-4)37-17-19-39(59-37)52(32-27-47(67-7)56(72-12)48(28-32)68-8)40-20-18-38(60-40)51(36-16-14-34(49)58-36)31-25-45(65-5)55(71-11)46(26-31)66-6/h13-28,57,60H,1-12H3/b49-33-,49-34-,50-35-,50-37-,51-36-,51-38-,52-39-,52-40- |
| InChIKey | WVYQOJACJYPRCF-ZNTHPLPZSA-N |
| XLogP | 11.43 |
| TPSA | 168.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.06 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |