About 2-methylimidazo[1,2-a]pyrazin-3-ol
2-methylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 135410169) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 2-methylimidazo[1,2-a]pyrazin-3-ol.
Molecular Properties
| Compound Name | 2-methylimidazo[1,2-a]pyrazin-3-ol |
| PubChem CID | 135410169 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2-methylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Cc1nc2cnccn2c1O |
| InChI | InChI=1S/C7H7N3O/c1-5-7(11)10-3-2-8-4-6(10)9-5/h2-4,11H,1H3 |
| InChIKey | GSFUNLAUWYNNCT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylimidazo[1,2-a]pyrazin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[1,2-a]pyrazin-3-ol?
The IUPAC name of 2-methylimidazo[1,2-a]pyrazin-3-ol (CID 135410169) is 2-methylimidazo[1,2-a]pyrazin-3-ol.
What is the SMILES notation for 2-methylimidazo[1,2-a]pyrazin-3-ol?
The canonical SMILES for 2-methylimidazo[1,2-a]pyrazin-3-ol is Cc1nc2cnccn2c1O.
What is the InChIKey of 2-methylimidazo[1,2-a]pyrazin-3-ol?
The InChIKey is GSFUNLAUWYNNCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-5-7(11)10-3-2-8-4-6(10)9-5/h2-4,11H,1H3.
What are the key properties of 2-methylimidazo[1,2-a]pyrazin-3-ol?
2-methylimidazo[1,2-a]pyrazin-3-ol has a molecular weight of 149.15 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-a]pyrazin-3-ol is sourced from PubChem (CID 135410169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).