C6H6N4O — CID 135410170
2-amino-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 135410170) has the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. Its IUPAC name is 2-amino-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-amino-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135410170 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2-amino-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Nc1nn2cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C6H6N4O/c7-6-8-5(11)4-2-1-3-10(4)9-6/h1-3H,(H3,7,8,9,11) |
| InChIKey | GOZHMTPUHBNEJV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |