C14H13N3O — CID 135410215
8-methoxy-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole (PubChem CID 135410215) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 8-methoxy-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole.
| Compound Name | 8-methoxy-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole |
|---|---|
| PubChem CID | 135410215 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 8-methoxy-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole |
| SMILES | COc1ccc2c3c([nH]c2c1)-c1[nH]ncc1CC3 |
| InChI | InChI=1S/C14H13N3O/c1-18-9-3-5-10-11-4-2-8-7-15-17-13(8)14(11)16-12(10)6-9/h3,5-7,16H,2,4H2,1H3,(H,15,17) |
| InChIKey | DYQTWZKCFNQLOR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|