C18H12F2N4O2 — CID 135410384
N-(2,5-difluorophenyl)-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide (PubChem CID 135410384) has the molecular formula C18H12F2N4O2 and a molecular weight of 354.32 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide |
|---|---|
| PubChem CID | 135410384 |
| Molecular Formula | C18H12F2N4O2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide |
| SMILES | O=C(Cn1ncc2c([nH]c3ccccc32)c1=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H12F2N4O2/c19-10-5-6-13(20)15(7-10)22-16(25)9-24-18(26)17-12(8-21-24)11-3-1-2-4-14(11)23-17/h1-8,23H,9H2,(H,22,25) |
| InChIKey | HAFXMRMCOXJMDJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |