C29H25FN6O4 — CID 135410442
6-N-(2,4-dimethylphenyl)-3-N-(4-fluorophenyl)-5-methyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide (PubChem CID 135410442) has the molecular formula C29H25FN6O4 and a molecular weight of 540.56 g/mol. Its IUPAC name is 6-N-(2,4-dimethylphenyl)-3-N-(4-fluorophenyl)-5-methyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide.
| Compound Name | 6-N-(2,4-dimethylphenyl)-3-N-(4-fluorophenyl)-5-methyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 135410442 |
| Molecular Formula | C29H25FN6O4 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 6-N-(2,4-dimethylphenyl)-3-N-(4-fluorophenyl)-5-methyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc([N+](=O)[O-])cc2)n2ncc(C(=O)Nc3ccc(F)cc3)c2N1 |
| InChI | InChI=1S/C29H25FN6O4/c1-16-4-13-24(17(2)14-16)34-29(38)25-18(3)32-27-23(28(37)33-21-9-7-20(30)8-10-21)15-31-35(27)26(25)19-5-11-22(12-6-19)36(39)40/h4-15,26,32H,1-3H3,(H,33,37)(H,34,38) |
| InChIKey | PUKNPAIYJMMTGC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|