C16H20N4O3 — CID 135410639
ethyl 4-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate (PubChem CID 135410639) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl 4-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate.
| Compound Name | ethyl 4-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 135410639 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | ethyl 4-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nnc(C(C)(C)C)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H20N4O3/c1-5-23-14(22)10-6-8-11(9-7-10)17-15-18-13(21)12(19-20-15)16(2,3)4/h6-9H,5H2,1-4H3,(H2,17,18,20,21) |
| InChIKey | BIXBMLJSGFZZQP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |