C10H12ClN3O2S — CID 135410919
7-chloro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135410919) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 7-chloro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 7-chloro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135410919 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 7-chloro-1,1-dioxo-N-propan-2-yl-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC(C)/N=C1\Nc2ccc(Cl)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C10H12ClN3O2S/c1-6(2)12-10-13-8-4-3-7(11)5-9(8)17(15,16)14-10/h3-6H,1-2H3,(H2,12,13,14) |
| InChIKey | GFZIHBNQPGWJPQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|