C28H30N6O7S2 — CID 135410993
4-hydroxy-3-[7-[(4-methoxyphenyl)methylsulfamoylamino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridin-2-one (PubChem CID 135410993) has the molecular formula C28H30N6O7S2 and a molecular weight of 626.72 g/mol. Its IUPAC name is 4-hydroxy-3-[7-[(4-methoxyphenyl)methylsulfamoylamino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridin-2-one.
| Compound Name | 4-hydroxy-3-[7-[(4-methoxyphenyl)methylsulfamoylamino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 135410993 |
| Molecular Formula | C28H30N6O7S2 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | 4-hydroxy-3-[7-[(4-methoxyphenyl)methylsulfamoylamino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridin-2-one |
| SMILES | COc1ccc(CNS(=O)(=O)Nc2ccc3c(c2)S(=O)(=O)N=C(c2c(O)c4cccnc4n(CCC(C)C)c2=O)N3)cc1 |
| InChI | InChI=1S/C28H30N6O7S2/c1-17(2)12-14-34-27-21(5-4-13-29-27)25(35)24(28(34)36)26-31-22-11-8-19(15-23(22)42(37,38)33-26)32-43(39,40)30-16-18-6-9-20(41-3)10-7-18/h4-11,13,15,17,30,32,35H,12,14,16H2,1-3H3,(H,31,33) |
| InChIKey | ODGIDYPLDCUVLP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 181.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |