About 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one
2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one (PubChem CID 135411143) has the molecular formula C8H6FN3O
and a molecular weight of 179.15 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one |
| PubChem CID | 135411143 |
| Molecular Formula | C8H6FN3O |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one |
| SMILES | O=c1[nH]cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C8H6FN3O/c9-6-1-3-7(4-2-6)12-8(13)10-5-11-12/h1-5H,(H,10,11,13) |
| InChIKey | PWOCHDDIRWYRRD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one?
The IUPAC name of 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one (CID 135411143) is 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one.
What is the SMILES notation for 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one?
The canonical SMILES for 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one is O=c1[nH]cnn1-c1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one?
The InChIKey is PWOCHDDIRWYRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O/c9-6-1-3-7(4-2-6)12-8(13)10-5-11-12/h1-5H,(H,10,11,13).
What are the key properties of 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one?
2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one has a molecular weight of 179.15 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-4H-1,2,4-triazol-3-one is sourced from PubChem (CID 135411143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).