C22H20N2O5 — CID 135411294
2-hydroxy-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]-2,2-diphenylacetamide (PubChem CID 135411294) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 135411294 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-hydroxy-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]-2,2-diphenylacetamide |
| SMILES | C/C(=N\NC(=O)C(O)(c1ccccc1)c1ccccc1)c1c(O)cc(C)oc1=O |
| InChI | InChI=1S/C22H20N2O5/c1-14-13-18(25)19(20(26)29-14)15(2)23-24-21(27)22(28,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13,25,28H,1-2H3,(H,24,27)/b23-15+ |
| InChIKey | RQUKSCRBZKQXFP-HZHRSRAPSA-N |
| XLogP | 2.43 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|