C20H18N4O5S — CID 135411640
4-[3-[(E)-N'-[(E)-1-(4-hydroxyphenyl)ethylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 135411640) has the molecular formula C20H18N4O5S and a molecular weight of 426.45 g/mol. Its IUPAC name is 4-[3-[(E)-N'-[(E)-1-(4-hydroxyphenyl)ethylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[3-[(E)-N'-[(E)-1-(4-hydroxyphenyl)ethylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 135411640 |
| Molecular Formula | C20H18N4O5S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 4-[3-[(E)-N'-[(E)-1-(4-hydroxyphenyl)ethylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | C/C(=N\N=C(/N)SC1CC(=O)N(c2ccc(C(=O)O)cc2)C1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H18N4O5S/c1-11(12-4-8-15(25)9-5-12)22-23-20(21)30-16-10-17(26)24(18(16)27)14-6-2-13(3-7-14)19(28)29/h2-9,16,25H,10H2,1H3,(H2,21,23)(H,28,29)/b22-11+ |
| InChIKey | YKFMSBAVIWNARE-SSDVNMTOSA-N |
| XLogP | 2.19 |
| TPSA | 145.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|