C18H14F3N5O2 — CID 135411755
N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]pyridine-3-carboxamide (PubChem CID 135411755) has the molecular formula C18H14F3N5O2 and a molecular weight of 389.34 g/mol. Its IUPAC name is N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135411755 |
| Molecular Formula | C18H14F3N5O2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]pyridine-3-carboxamide |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C(=N/NC(=O)c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C18H14F3N5O2/c1-11-14(17(28)26(25-11)13-7-3-2-4-8-13)15(18(19,20)21)23-24-16(27)12-6-5-9-22-10-12/h2-10,25H,1H3,(H,24,27)/b23-15- |
| InChIKey | LQDBUMLLIZABGN-HAHDFKILSA-N |
| XLogP | 2.57 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|