C17H22N2O3 — CID 135411805
ethyl (2E)-2-hydroxyimino-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)acetate (PubChem CID 135411805) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl (2E)-2-hydroxyimino-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)acetate.
| Compound Name | ethyl (2E)-2-hydroxyimino-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)acetate |
|---|---|
| PubChem CID | 135411805 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | ethyl (2E)-2-hydroxyimino-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)acetate |
| SMILES | CCOC(=O)/C(=N/O)C1=NC(C)(C)Cc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C17H22N2O3/c1-6-22-16(20)15(19-21)14-13-8-11(3)10(2)7-12(13)9-17(4,5)18-14/h7-8,21H,6,9H2,1-5H3/b19-15+ |
| InChIKey | KMYBVHNBKGNQDJ-XDJHFCHBSA-N |
| XLogP | 2.82 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|