About 4-amino-2,1,3-benzothiadiazol-5-ol
4-amino-2,1,3-benzothiadiazol-5-ol (PubChem CID 135411839) has the molecular formula C6H5N3OS
and a molecular weight of 167.19 g/mol. Its IUPAC name is 4-amino-2,1,3-benzothiadiazol-5-ol.
Molecular Properties
| Compound Name | 4-amino-2,1,3-benzothiadiazol-5-ol |
| PubChem CID | 135411839 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 4-amino-2,1,3-benzothiadiazol-5-ol |
| SMILES | Nc1c(O)ccc2nsnc12 |
| InChI | InChI=1S/C6H5N3OS/c7-5-4(10)2-1-3-6(5)9-11-8-3/h1-2,10H,7H2 |
| InChIKey | PFZFOLWGDZOUIU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,1,3-benzothiadiazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,1,3-benzothiadiazol-5-ol?
The IUPAC name of 4-amino-2,1,3-benzothiadiazol-5-ol (CID 135411839) is 4-amino-2,1,3-benzothiadiazol-5-ol.
What is the SMILES notation for 4-amino-2,1,3-benzothiadiazol-5-ol?
The canonical SMILES for 4-amino-2,1,3-benzothiadiazol-5-ol is Nc1c(O)ccc2nsnc12.
What is the InChIKey of 4-amino-2,1,3-benzothiadiazol-5-ol?
The InChIKey is PFZFOLWGDZOUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3OS/c7-5-4(10)2-1-3-6(5)9-11-8-3/h1-2,10H,7H2.
What are the key properties of 4-amino-2,1,3-benzothiadiazol-5-ol?
4-amino-2,1,3-benzothiadiazol-5-ol has a molecular weight of 167.19 g/mol, XLogP of 0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,1,3-benzothiadiazol-5-ol is sourced from PubChem (CID 135411839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).