About N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide
N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide (PubChem CID 135411910) has the molecular formula C17H23N3O4
and a molecular weight of 333.39 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide |
| PubChem CID | 135411910 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide |
| SMILES | COc1cc(/C=N/NC(=O)CC(=O)NC2CCCCC2)ccc1O |
| InChI | InChI=1S/C17H23N3O4/c1-24-15-9-12(7-8-14(15)21)11-18-20-17(23)10-16(22)19-13-5-3-2-4-6-13/h7-9,11,13,21H,2-6,10H2,1H3,(H,19,22)(H,20,23)/b18-11+ |
| InChIKey | RZHWYGFDZUESMY-WOJGMQOQSA-N |
| XLogP | 1.69 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide?
The IUPAC name of N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide (CID 135411910) is N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide.
What is the SMILES notation for N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide?
The canonical SMILES for N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide is COc1cc(/C=N/NC(=O)CC(=O)NC2CCCCC2)ccc1O.
What is the InChIKey of N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide?
The InChIKey is RZHWYGFDZUESMY-WOJGMQOQSA-N. The full InChI is InChI=1S/C17H23N3O4/c1-24-15-9-12(7-8-14(15)21)11-18-20-17(23)10-16(22)19-13-5-3-2-4-6-13/h7-9,11,13,21H,2-6,10H2,1H3,(H,19,22)(H,20,23)/b18-11+.
What are the key properties of N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide?
N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide has a molecular weight of 333.39 g/mol, XLogP of 1.69, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]propanediamide is sourced from PubChem (CID 135411910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).