About 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol
2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol (PubChem CID 135411964) has the molecular formula C9H6I2N4O
and a molecular weight of 439.98 g/mol. Its IUPAC name is 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol.
Molecular Properties
| Compound Name | 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol |
| PubChem CID | 135411964 |
| Molecular Formula | C9H6I2N4O |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.86 |
| IUPAC Name | 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/n1cnnc1 |
| InChI | InChI=1S/C9H6I2N4O/c10-7-1-6(9(16)8(11)2-7)3-14-15-4-12-13-5-15/h1-5,16H/b14-3+ |
| InChIKey | UVVONDVEIXSCOF-LZWSPWQCSA-N |
| XLogP | 2.08 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The IUPAC name of 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol (CID 135411964) is 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol.
What is the SMILES notation for 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The canonical SMILES for 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol is Oc1c(I)cc(I)cc1/C=N/n1cnnc1.
What is the InChIKey of 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The InChIKey is UVVONDVEIXSCOF-LZWSPWQCSA-N. The full InChI is InChI=1S/C9H6I2N4O/c10-7-1-6(9(16)8(11)2-7)3-14-15-4-12-13-5-15/h1-5,16H/b14-3+.
What are the key properties of 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol has a molecular weight of 439.98 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diiodo-6-[(E)-1,2,4-triazol-4-yliminomethyl]phenol is sourced from PubChem (CID 135411964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).