C12H12N2OS — CID 135412224
2-benzylsulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 135412224) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-benzylsulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135412224 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-benzylsulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(SCc2ccccc2)n1 |
| InChI | InChI=1S/C12H12N2OS/c1-9-7-11(15)14-12(13-9)16-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,13,14,15) |
| InChIKey | IJCWZWYJJJGSBT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |