About 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one
3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135412542) has the molecular formula C11H9N5O
and a molecular weight of 227.23 g/mol. Its IUPAC name is 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135412542 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]cnc2c1nnn2Cc1ccccc1 |
| InChI | InChI=1S/C11H9N5O/c17-11-9-10(12-7-13-11)16(15-14-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,12,13,17) |
| InChIKey | GKILZMOZUNSGBZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one (CID 135412542) is 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one is O=c1[nH]cnc2c1nnn2Cc1ccccc1.
What is the InChIKey of 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The InChIKey is GKILZMOZUNSGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5O/c17-11-9-10(12-7-13-11)16(15-14-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,12,13,17).
What are the key properties of 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one?
3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one has a molecular weight of 227.23 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135412542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).