C10H8N4O — CID 135412651
4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 135412651) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 135412651 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | Cc1cc2ncc3c(=O)[nH]ccc3n2n1 |
| InChI | InChI=1S/C10H8N4O/c1-6-4-9-12-5-7-8(14(9)13-6)2-3-11-10(7)15/h2-5H,1H3,(H,11,15) |
| InChIKey | HYOOBRPVUSOPLS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |