About 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one
6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one (PubChem CID 135412750) has the molecular formula C14H16FN3O2
and a molecular weight of 277.30 g/mol. Its IUPAC name is 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one.
Molecular Properties
| Compound Name | 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one |
| PubChem CID | 135412750 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one |
| SMILES | C/N=C1\NC(=O)C2(CC(C)(C)Oc3ccc(F)cc32)N1 |
| InChI | InChI=1S/C14H16FN3O2/c1-13(2)7-14(11(19)17-12(16-3)18-14)9-6-8(15)4-5-10(9)20-13/h4-6H,7H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | UUKCTNPZHJLYMC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one?
The IUPAC name of 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one (CID 135412750) is 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one.
What is the SMILES notation for 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one?
The canonical SMILES for 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one is C/N=C1\NC(=O)C2(CC(C)(C)Oc3ccc(F)cc32)N1.
What is the InChIKey of 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one?
The InChIKey is UUKCTNPZHJLYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN3O2/c1-13(2)7-14(11(19)17-12(16-3)18-14)9-6-8(15)4-5-10(9)20-13/h4-6H,7H2,1-3H3,(H2,16,17,18,19).
What are the key properties of 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one?
6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one has a molecular weight of 277.30 g/mol, XLogP of 1.29, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,2-dimethyl-2'-methyliminospiro[3H-chromene-4,5'-imidazolidine]-4'-one is sourced from PubChem (CID 135412750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).